C19H25ClF3NO6 — CID 158986273
2-[[(2S,3R,4S,5S)-2-[2-(4-chlorophenyl)ethyl]-4-methoxy-5-methyloxan-3-yl]amino]acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 158986273) has the molecular formula C19H25ClF3NO6 and a molecular weight of 455.86 g/mol. Its IUPAC name is 2-[[(2S,3R,4S,5S)-2-[2-(4-chlorophenyl)ethyl]-4-methoxy-5-methyloxan-3-yl]amino]acetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(2S,3R,4S,5S)-2-[2-(4-chlorophenyl)ethyl]-4-methoxy-5-methyloxan-3-yl]amino]acetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 158986273 |
| Molecular Formula | C19H25ClF3NO6 |
| Molecular Weight | 455.86 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 2-[[(2S,3R,4S,5S)-2-[2-(4-chlorophenyl)ethyl]-4-methoxy-5-methyloxan-3-yl]amino]acetic acid;2,2,2-trifluoroacetic acid |
| SMILES | CO[C@@H]1[C@H](NCC(=O)O)[C@H](CCc2ccc(Cl)cc2)OC[C@@H]1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24ClNO4.C2HF3O2/c1-11-10-23-14(8-5-12-3-6-13(18)7-4-12)16(17(11)22-2)19-9-15(20)21;3-2(4,5)1(6)7/h3-4,6-7,11,14,16-17,19H,5,8-10H2,1-2H3,(H,20,21);(H,6,7)/t11-,14-,16+,17-;/m0./s1 |
| InChIKey | VWBZRWCVGVWATE-ZGTYUBDVSA-N |
| XLogP | 3.00 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.86 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |