About N'-methyl-N'-[(4-phenyl-1H-imidazol-5-yl)methyl]ethane-1,2-diamine
N'-methyl-N'-[(4-phenyl-1H-imidazol-5-yl)methyl]ethane-1,2-diamine (PubChem CID 158986522) has the molecular formula C26H36N8
and a molecular weight of 460.63 g/mol. Its IUPAC name is N'-methyl-N'-[(4-phenyl-1H-imidazol-5-yl)methyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-methyl-N'-[(4-phenyl-1H-imidazol-5-yl)methyl]ethane-1,2-diamine |
| PubChem CID | 158986522 |
| Molecular Formula | C26H36N8 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | N'-methyl-N'-[(4-phenyl-1H-imidazol-5-yl)methyl]ethane-1,2-diamine |
| SMILES | CN(CCN)Cc1[nH]cnc1-c1ccccc1.CN(CCN)Cc1[nH]cnc1-c1ccccc1 |
| InChI | InChI=1S/2C13H18N4/c2*1-17(8-7-14)9-12-13(16-10-15-12)11-5-3-2-4-6-11/h2*2-6,10H,7-9,14H2,1H3,(H,15,16) |
| InChIKey | JPQDSCMSZWPTQH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 115.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N'-methyl-N'-[(4-phenyl-1H-imidazol-5-yl)methyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-[(4-phenyl-1H-imidazol-5-yl)methyl]ethane-1,2-diamine?
The IUPAC name of N'-methyl-N'-[(4-phenyl-1H-imidazol-5-yl)methyl]ethane-1,2-diamine (CID 158986522) is N'-methyl-N'-[(4-phenyl-1H-imidazol-5-yl)methyl]ethane-1,2-diamine.
What is the SMILES notation for N'-methyl-N'-[(4-phenyl-1H-imidazol-5-yl)methyl]ethane-1,2-diamine?
The canonical SMILES for N'-methyl-N'-[(4-phenyl-1H-imidazol-5-yl)methyl]ethane-1,2-diamine is CN(CCN)Cc1[nH]cnc1-c1ccccc1.CN(CCN)Cc1[nH]cnc1-c1ccccc1.
What is the InChIKey of N'-methyl-N'-[(4-phenyl-1H-imidazol-5-yl)methyl]ethane-1,2-diamine?
The InChIKey is JPQDSCMSZWPTQH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H18N4/c2*1-17(8-7-14)9-12-13(16-10-15-12)11-5-3-2-4-6-11/h2*2-6,10H,7-9,14H2,1H3,(H,15,16).
What are the key properties of N'-methyl-N'-[(4-phenyl-1H-imidazol-5-yl)methyl]ethane-1,2-diamine?
N'-methyl-N'-[(4-phenyl-1H-imidazol-5-yl)methyl]ethane-1,2-diamine has a molecular weight of 460.63 g/mol, XLogP of 2.93, 10 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-[(4-phenyl-1H-imidazol-5-yl)methyl]ethane-1,2-diamine is sourced from PubChem (CID 158986522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).