About 4-bromo-5-methylbenzene-1,2-diamine;5-bromo-6-methyl-1H-benzimidazole;formic acid
4-bromo-5-methylbenzene-1,2-diamine;5-bromo-6-methyl-1H-benzimidazole;formic acid (PubChem CID 158989631) has the molecular formula C16H18Br2N4O2
and a molecular weight of 458.15 g/mol. Its IUPAC name is 4-bromo-5-methylbenzene-1,2-diamine;5-bromo-6-methyl-1H-benzimidazole;formic acid.
Molecular Properties
| Compound Name | 4-bromo-5-methylbenzene-1,2-diamine;5-bromo-6-methyl-1H-benzimidazole;formic acid |
| PubChem CID | 158989631 |
| Molecular Formula | C16H18Br2N4O2 |
| Molecular Weight | 458.15 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | 4-bromo-5-methylbenzene-1,2-diamine;5-bromo-6-methyl-1H-benzimidazole;formic acid |
| SMILES | Cc1cc(N)c(N)cc1Br.Cc1cc2[nH]cnc2cc1Br.O=CO |
| InChI | InChI=1S/C8H7BrN2.C7H9BrN2.CH2O2/c1-5-2-7-8(3-6(5)9)11-4-10-7;1-4-2-6(9)7(10)3-5(4)8;2-1-3/h2-4H,1H3,(H,10,11);2-3H,9-10H2,1H3;1H,(H,2,3) |
| InChIKey | JPZPYAVPXZDKOJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.15 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-5-methylbenzene-1,2-diamine;5-bromo-6-methyl-1H-benzimidazole;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-methylbenzene-1,2-diamine;5-bromo-6-methyl-1H-benzimidazole;formic acid?
The IUPAC name of 4-bromo-5-methylbenzene-1,2-diamine;5-bromo-6-methyl-1H-benzimidazole;formic acid (CID 158989631) is 4-bromo-5-methylbenzene-1,2-diamine;5-bromo-6-methyl-1H-benzimidazole;formic acid.
What is the SMILES notation for 4-bromo-5-methylbenzene-1,2-diamine;5-bromo-6-methyl-1H-benzimidazole;formic acid?
The canonical SMILES for 4-bromo-5-methylbenzene-1,2-diamine;5-bromo-6-methyl-1H-benzimidazole;formic acid is Cc1cc(N)c(N)cc1Br.Cc1cc2[nH]cnc2cc1Br.O=CO.
What is the InChIKey of 4-bromo-5-methylbenzene-1,2-diamine;5-bromo-6-methyl-1H-benzimidazole;formic acid?
The InChIKey is JPZPYAVPXZDKOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN2.C7H9BrN2.CH2O2/c1-5-2-7-8(3-6(5)9)11-4-10-7;1-4-2-6(9)7(10)3-5(4)8;2-1-3/h2-4H,1H3,(H,10,11);2-3H,9-10H2,1H3;1H,(H,2,3).
What are the key properties of 4-bromo-5-methylbenzene-1,2-diamine;5-bromo-6-methyl-1H-benzimidazole;formic acid?
4-bromo-5-methylbenzene-1,2-diamine;5-bromo-6-methyl-1H-benzimidazole;formic acid has a molecular weight of 458.15 g/mol, XLogP of 4.26, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-methylbenzene-1,2-diamine;5-bromo-6-methyl-1H-benzimidazole;formic acid is sourced from PubChem (CID 158989631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).