C33H49N2O5+ — CID 158989791
4-[(1R)-2-[4-[(3R)-3-[(2S)-2-cyclopentyl-2-hydroxy-2-phenylethoxy]-1-azoniabicyclo[2.2.2]octan-1-yl]butylamino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol (PubChem CID 158989791) has the molecular formula C33H49N2O5+ and a molecular weight of 553.76 g/mol. Its IUPAC name is 4-[(1R)-2-[4-[(3R)-3-[(2S)-2-cyclopentyl-2-hydroxy-2-phenylethoxy]-1-azoniabicyclo[2.2.2]octan-1-yl]butylamino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol.
| Compound Name | 4-[(1R)-2-[4-[(3R)-3-[(2S)-2-cyclopentyl-2-hydroxy-2-phenylethoxy]-1-azoniabicyclo[2.2.2]octan-1-yl]butylamino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 158989791 |
| Molecular Formula | C33H49N2O5+ |
| Molecular Weight | 553.76 g/mol |
| Exact Mass | 553.36 |
| IUPAC Name | 4-[(1R)-2-[4-[(3R)-3-[(2S)-2-cyclopentyl-2-hydroxy-2-phenylethoxy]-1-azoniabicyclo[2.2.2]octan-1-yl]butylamino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol |
| SMILES | OCc1cc([C@@H](O)CNCCCC[N+]23CCC(CC2)[C@@H](OC[C@@](O)(c2ccccc2)C2CCCC2)C3)ccc1O |
| InChI | InChI=1S/C33H48N2O5/c36-23-27-20-26(12-13-30(27)37)31(38)21-34-16-6-7-17-35-18-14-25(15-19-35)32(22-35)40-24-33(39,29-10-4-5-11-29)28-8-2-1-3-9-28/h1-3,8-9,12-13,20,25,29,31-32,34,36,38-39H,4-7,10-11,14-19,21-24H2/p+1/t25?,31-,32-,33+,35?/m0/s1 |
| InChIKey | IOQQUZIISYUALW-VLFLRASVSA-O |
| XLogP | 3.99 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.76 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|