About cyclopentanone;4-fluorobenzaldehyde;(2E)-2-[(4-fluorophenyl)methylidene]cyclopentan-1-one
cyclopentanone;4-fluorobenzaldehyde;(2E)-2-[(4-fluorophenyl)methylidene]cyclopentan-1-one (PubChem CID 158989838) has the molecular formula C24H24F2O3
and a molecular weight of 398.45 g/mol. Its IUPAC name is cyclopentanone;4-fluorobenzaldehyde;(2E)-2-[(4-fluorophenyl)methylidene]cyclopentan-1-one.
Molecular Properties
| Compound Name | cyclopentanone;4-fluorobenzaldehyde;(2E)-2-[(4-fluorophenyl)methylidene]cyclopentan-1-one |
| PubChem CID | 158989838 |
| Molecular Formula | C24H24F2O3 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | cyclopentanone;4-fluorobenzaldehyde;(2E)-2-[(4-fluorophenyl)methylidene]cyclopentan-1-one |
| SMILES | O=C1CCC/C1=C\c1ccc(F)cc1.O=C1CCCC1.O=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C12H11FO.C7H5FO.C5H8O/c13-11-6-4-9(5-7-11)8-10-2-1-3-12(10)14;8-7-3-1-6(5-9)2-4-7;6-5-3-1-2-4-5/h4-8H,1-3H2;1-5H;1-4H2/b10-8+;; |
| InChIKey | JQAFKADXAUYFPP-PIHABLKOSA-N |
| XLogP | 5.73 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyclopentanone;4-fluorobenzaldehyde;(2E)-2-[(4-fluorophenyl)methylidene]cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentanone;4-fluorobenzaldehyde;(2E)-2-[(4-fluorophenyl)methylidene]cyclopentan-1-one?
The IUPAC name of cyclopentanone;4-fluorobenzaldehyde;(2E)-2-[(4-fluorophenyl)methylidene]cyclopentan-1-one (CID 158989838) is cyclopentanone;4-fluorobenzaldehyde;(2E)-2-[(4-fluorophenyl)methylidene]cyclopentan-1-one.
What is the SMILES notation for cyclopentanone;4-fluorobenzaldehyde;(2E)-2-[(4-fluorophenyl)methylidene]cyclopentan-1-one?
The canonical SMILES for cyclopentanone;4-fluorobenzaldehyde;(2E)-2-[(4-fluorophenyl)methylidene]cyclopentan-1-one is O=C1CCC/C1=C\c1ccc(F)cc1.O=C1CCCC1.O=Cc1ccc(F)cc1.
What is the InChIKey of cyclopentanone;4-fluorobenzaldehyde;(2E)-2-[(4-fluorophenyl)methylidene]cyclopentan-1-one?
The InChIKey is JQAFKADXAUYFPP-PIHABLKOSA-N. The full InChI is InChI=1S/C12H11FO.C7H5FO.C5H8O/c13-11-6-4-9(5-7-11)8-10-2-1-3-12(10)14;8-7-3-1-6(5-9)2-4-7;6-5-3-1-2-4-5/h4-8H,1-3H2;1-5H;1-4H2/b10-8+;;.
What are the key properties of cyclopentanone;4-fluorobenzaldehyde;(2E)-2-[(4-fluorophenyl)methylidene]cyclopentan-1-one?
cyclopentanone;4-fluorobenzaldehyde;(2E)-2-[(4-fluorophenyl)methylidene]cyclopentan-1-one has a molecular weight of 398.45 g/mol, XLogP of 5.73, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanone;4-fluorobenzaldehyde;(2E)-2-[(4-fluorophenyl)methylidene]cyclopentan-1-one is sourced from PubChem (CID 158989838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).