About 2,4,6-trichloropyrimidine
2,4,6-trichloropyrimidine (PubChem CID 158990073) has the molecular formula C8H2Cl6N4
and a molecular weight of 366.85 g/mol. Its IUPAC name is 2,4,6-trichloropyrimidine.
Molecular Properties
| Compound Name | 2,4,6-trichloropyrimidine |
| PubChem CID | 158990073 |
| Molecular Formula | C8H2Cl6N4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 363.84 |
| IUPAC Name | 2,4,6-trichloropyrimidine |
| SMILES | Clc1cc(Cl)nc(Cl)n1.Clc1cc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/2C4HCl3N2/c2*5-2-1-3(6)9-4(7)8-2/h2*1H |
| InChIKey | JQAYJJWJJJWLTR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4,6-trichloropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-trichloropyrimidine?
The IUPAC name of 2,4,6-trichloropyrimidine (CID 158990073) is 2,4,6-trichloropyrimidine.
What is the SMILES notation for 2,4,6-trichloropyrimidine?
The canonical SMILES for 2,4,6-trichloropyrimidine is Clc1cc(Cl)nc(Cl)n1.Clc1cc(Cl)nc(Cl)n1.
What is the InChIKey of 2,4,6-trichloropyrimidine?
The InChIKey is JQAYJJWJJJWLTR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4HCl3N2/c2*5-2-1-3(6)9-4(7)8-2/h2*1H.
What are the key properties of 2,4,6-trichloropyrimidine?
2,4,6-trichloropyrimidine has a molecular weight of 366.85 g/mol, XLogP of 4.87, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-trichloropyrimidine is sourced from PubChem (CID 158990073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).