C41H89IN2O2Si2 — CID 158990747
1-(dimethylamino)-15-trimethylsilylpentadecan-5-one;trimethyl-(5-oxo-15-trimethylsilylpentadecyl)azanium;iodide (PubChem CID 158990747) has the molecular formula C41H89IN2O2Si2 and a molecular weight of 825.25 g/mol. Its IUPAC name is 1-(dimethylamino)-15-trimethylsilylpentadecan-5-one;trimethyl-(5-oxo-15-trimethylsilylpentadecyl)azanium;iodide.
| Compound Name | 1-(dimethylamino)-15-trimethylsilylpentadecan-5-one;trimethyl-(5-oxo-15-trimethylsilylpentadecyl)azanium;iodide |
|---|---|
| PubChem CID | 158990747 |
| Molecular Formula | C41H89IN2O2Si2 |
| Molecular Weight | 825.25 g/mol |
| Exact Mass | 824.55 |
| IUPAC Name | 1-(dimethylamino)-15-trimethylsilylpentadecan-5-one;trimethyl-(5-oxo-15-trimethylsilylpentadecyl)azanium;iodide |
| SMILES | CN(C)CCCCC(=O)CCCCCCCCCC[Si](C)(C)C.C[N+](C)(C)CCCCC(=O)CCCCCCCCCC[Si](C)(C)C.[I-] |
| InChI | InChI=1S/C21H46NOSi.C20H43NOSi.HI/c1-22(2,3)19-15-14-18-21(23)17-13-11-9-7-8-10-12-16-20-24(4,5)6;1-21(2)18-14-13-17-20(22)16-12-10-8-6-7-9-11-15-19-23(3,4)5;/h7-20H2,1-6H3;6-19H2,1-5H3;1H/q+1;;/p-1 |
| InChIKey | RAMMYIDSUXSVEV-UHFFFAOYSA-M |
| XLogP | 9.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.25 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|