C19H20N2O5 — CID 158991927
1-(2-aminoethyl)-3-hydroxypyridin-4-one;3-phenylmethoxypyran-4-one (PubChem CID 158991927) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-hydroxypyridin-4-one;3-phenylmethoxypyran-4-one.
| Compound Name | 1-(2-aminoethyl)-3-hydroxypyridin-4-one;3-phenylmethoxypyran-4-one |
|---|---|
| PubChem CID | 158991927 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-(2-aminoethyl)-3-hydroxypyridin-4-one;3-phenylmethoxypyran-4-one |
| SMILES | NCCn1ccc(=O)c(O)c1.O=c1ccocc1OCc1ccccc1 |
| InChI | InChI=1S/C12H10O3.C7H10N2O2/c13-11-6-7-14-9-12(11)15-8-10-4-2-1-3-5-10;8-2-4-9-3-1-6(10)7(11)5-9/h1-7,9H,8H2;1,3,5,11H,2,4,8H2 |
| InChIKey | JQGPIYRQRYVIMZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |