C24H33F5N2O5 — CID 158993600
[5-[2-[2-[2-hydroxyethyl-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]ethoxy]-2-oxoethyl]-1,3,3-trimethylcyclohexyl]methylcarbamic acid (PubChem CID 158993600) has the molecular formula C24H33F5N2O5 and a molecular weight of 524.53 g/mol. Its IUPAC name is [5-[2-[2-[2-hydroxyethyl-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]ethoxy]-2-oxoethyl]-1,3,3-trimethylcyclohexyl]methylcarbamic acid.
| Compound Name | [5-[2-[2-[2-hydroxyethyl-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]ethoxy]-2-oxoethyl]-1,3,3-trimethylcyclohexyl]methylcarbamic acid |
|---|---|
| PubChem CID | 158993600 |
| Molecular Formula | C24H33F5N2O5 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | [5-[2-[2-[2-hydroxyethyl-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]ethoxy]-2-oxoethyl]-1,3,3-trimethylcyclohexyl]methylcarbamic acid |
| SMILES | CC1(C)CC(CC(=O)OCCN(CCO)Cc2c(F)c(F)c(F)c(F)c2F)CC(C)(CNC(=O)O)C1 |
| InChI | InChI=1S/C24H33F5N2O5/c1-23(2)9-14(10-24(3,12-23)13-30-22(34)35)8-16(33)36-7-5-31(4-6-32)11-15-17(25)19(27)21(29)20(28)18(15)26/h14,30,32H,4-13H2,1-3H3,(H,34,35) |
| InChIKey | JQLSPZLOSAZBOC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|