About 2H-benzotriazole;hexylbenzene
2H-benzotriazole;hexylbenzene (PubChem CID 158994686) has the molecular formula C18H23N3
and a molecular weight of 281.40 g/mol. Its IUPAC name is 2H-benzotriazole;hexylbenzene.
Molecular Properties
| Compound Name | 2H-benzotriazole;hexylbenzene |
| PubChem CID | 158994686 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 2H-benzotriazole;hexylbenzene |
| SMILES | CCCCCCc1ccccc1.c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C12H18.C6H5N3/c1-2-3-4-6-9-12-10-7-5-8-11-12;1-2-4-6-5(3-1)7-9-8-6/h5,7-8,10-11H,2-4,6,9H2,1H3;1-4H,(H,7,8,9) |
| InChIKey | JQOZIAHAPSSPAD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2H-benzotriazole;hexylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazole;hexylbenzene?
The IUPAC name of 2H-benzotriazole;hexylbenzene (CID 158994686) is 2H-benzotriazole;hexylbenzene.
What is the SMILES notation for 2H-benzotriazole;hexylbenzene?
The canonical SMILES for 2H-benzotriazole;hexylbenzene is CCCCCCc1ccccc1.c1ccc2n[nH]nc2c1.
What is the InChIKey of 2H-benzotriazole;hexylbenzene?
The InChIKey is JQOZIAHAPSSPAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C6H5N3/c1-2-3-4-6-9-12-10-7-5-8-11-12;1-2-4-6-5(3-1)7-9-8-6/h5,7-8,10-11H,2-4,6,9H2,1H3;1-4H,(H,7,8,9).
What are the key properties of 2H-benzotriazole;hexylbenzene?
2H-benzotriazole;hexylbenzene has a molecular weight of 281.40 g/mol, XLogP of 4.77, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazole;hexylbenzene is sourced from PubChem (CID 158994686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).