C19H34N2O2 — CID 15899507
(E)-5-[2-[[(E)-5,5-dimethyl-4-oxohex-2-en-2-yl]amino]propylamino]-2,2-dimethylhex-4-en-3-one (PubChem CID 15899507) has the molecular formula C19H34N2O2 and a molecular weight of 322.49 g/mol. Its IUPAC name is (E)-5-[2-[[(E)-5,5-dimethyl-4-oxohex-2-en-2-yl]amino]propylamino]-2,2-dimethylhex-4-en-3-one.
| Compound Name | (E)-5-[2-[[(E)-5,5-dimethyl-4-oxohex-2-en-2-yl]amino]propylamino]-2,2-dimethylhex-4-en-3-one |
|---|---|
| PubChem CID | 15899507 |
| Molecular Formula | C19H34N2O2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.26 |
| IUPAC Name | (E)-5-[2-[[(E)-5,5-dimethyl-4-oxohex-2-en-2-yl]amino]propylamino]-2,2-dimethylhex-4-en-3-one |
| SMILES | C/C(=C\C(=O)C(C)(C)C)NCC(C)N/C(C)=C/C(=O)C(C)(C)C |
| InChI | InChI=1S/C19H34N2O2/c1-13(10-16(22)18(4,5)6)20-12-15(3)21-14(2)11-17(23)19(7,8)9/h10-11,15,20-21H,12H2,1-9H3/b13-10+,14-11+ |
| InChIKey | TXHHDNHIRMYIGZ-IFQMDVHZSA-N |
| XLogP | 3.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|