C24H25ClN2O7S — CID 158995173
1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethyl-4-(4-nitrophenyl)sulfonylpyrrole-2-carboxylic acid (PubChem CID 158995173) has the molecular formula C24H25ClN2O7S and a molecular weight of 520.99 g/mol. Its IUPAC name is 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethyl-4-(4-nitrophenyl)sulfonylpyrrole-2-carboxylic acid.
| Compound Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethyl-4-(4-nitrophenyl)sulfonylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 158995173 |
| Molecular Formula | C24H25ClN2O7S |
| Molecular Weight | 520.99 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethyl-4-(4-nitrophenyl)sulfonylpyrrole-2-carboxylic acid |
| SMILES | Cc1cc(OCCCn2c(C)c(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)c(C)c2C(=O)O)cc(C)c1Cl |
| InChI | InChI=1S/C24H25ClN2O7S/c1-14-12-19(13-15(2)21(14)25)34-11-5-10-26-17(4)23(16(3)22(26)24(28)29)35(32,33)20-8-6-18(7-9-20)27(30)31/h6-9,12-13H,5,10-11H2,1-4H3,(H,28,29) |
| InChIKey | JQQPMDQMQDNKBO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.99 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|