About cyclobutylmethanamine;4-fluoro-2-(trifluoromethyl)aniline
cyclobutylmethanamine;4-fluoro-2-(trifluoromethyl)aniline (PubChem CID 158995511) has the molecular formula C12H16F4N2
and a molecular weight of 264.27 g/mol. Its IUPAC name is cyclobutylmethanamine;4-fluoro-2-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | cyclobutylmethanamine;4-fluoro-2-(trifluoromethyl)aniline |
| PubChem CID | 158995511 |
| Molecular Formula | C12H16F4N2 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | cyclobutylmethanamine;4-fluoro-2-(trifluoromethyl)aniline |
| SMILES | NCC1CCC1.Nc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C7H5F4N.C5H11N/c8-4-1-2-6(12)5(3-4)7(9,10)11;6-4-5-2-1-3-5/h1-3H,12H2;5H,1-4,6H2 |
| InChIKey | JQRPYBAIQPPCKW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze cyclobutylmethanamine;4-fluoro-2-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutylmethanamine;4-fluoro-2-(trifluoromethyl)aniline?
The IUPAC name of cyclobutylmethanamine;4-fluoro-2-(trifluoromethyl)aniline (CID 158995511) is cyclobutylmethanamine;4-fluoro-2-(trifluoromethyl)aniline.
What is the SMILES notation for cyclobutylmethanamine;4-fluoro-2-(trifluoromethyl)aniline?
The canonical SMILES for cyclobutylmethanamine;4-fluoro-2-(trifluoromethyl)aniline is NCC1CCC1.Nc1ccc(F)cc1C(F)(F)F.
What is the InChIKey of cyclobutylmethanamine;4-fluoro-2-(trifluoromethyl)aniline?
The InChIKey is JQRPYBAIQPPCKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F4N.C5H11N/c8-4-1-2-6(12)5(3-4)7(9,10)11;6-4-5-2-1-3-5/h1-3H,12H2;5H,1-4,6H2.
What are the key properties of cyclobutylmethanamine;4-fluoro-2-(trifluoromethyl)aniline?
cyclobutylmethanamine;4-fluoro-2-(trifluoromethyl)aniline has a molecular weight of 264.27 g/mol, XLogP of 3.17, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutylmethanamine;4-fluoro-2-(trifluoromethyl)aniline is sourced from PubChem (CID 158995511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).