About 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;1H-imidazole
4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;1H-imidazole (PubChem CID 158995551) has the molecular formula C11H15N3O3
and a molecular weight of 237.26 g/mol. Its IUPAC name is 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;1H-imidazole.
Molecular Properties
| Compound Name | 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;1H-imidazole |
| PubChem CID | 158995551 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;1H-imidazole |
| SMILES | Cc1ncc(CO)c(CO)c1O.c1c[nH]cn1 |
| InChI | InChI=1S/C8H11NO3.C3H4N2/c1-5-8(12)7(4-11)6(3-10)2-9-5;1-2-5-3-4-1/h2,10-12H,3-4H2,1H3;1-3H,(H,4,5) |
| InChIKey | JQRSVQWCCCMVDL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;1H-imidazole?
The IUPAC name of 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;1H-imidazole (CID 158995551) is 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;1H-imidazole.
What is the SMILES notation for 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;1H-imidazole?
The canonical SMILES for 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;1H-imidazole is Cc1ncc(CO)c(CO)c1O.c1c[nH]cn1.
What is the InChIKey of 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;1H-imidazole?
The InChIKey is JQRSVQWCCCMVDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3.C3H4N2/c1-5-8(12)7(4-11)6(3-10)2-9-5;1-2-5-3-4-1/h2,10-12H,3-4H2,1H3;1-3H,(H,4,5).
What are the key properties of 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;1H-imidazole?
4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;1H-imidazole has a molecular weight of 237.26 g/mol, XLogP of 0.49, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;1H-imidazole is sourced from PubChem (CID 158995551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).