C31H25Cl3F2N6O3 — CID 158996149
6-chloro-7-(2,3-dichloro-4,5-difluoro-6-hydroxyphenyl)-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-2-oxo-4-(4-prop-2-enoylpiperazin-1-yl)-1,8-naphthyridine-3-carbonitrile (PubChem CID 158996149) has the molecular formula C31H25Cl3F2N6O3 and a molecular weight of 673.94 g/mol. Its IUPAC name is 6-chloro-7-(2,3-dichloro-4,5-difluoro-6-hydroxyphenyl)-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-2-oxo-4-(4-prop-2-enoylpiperazin-1-yl)-1,8-naphthyridine-3-carbonitrile.
| Compound Name | 6-chloro-7-(2,3-dichloro-4,5-difluoro-6-hydroxyphenyl)-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-2-oxo-4-(4-prop-2-enoylpiperazin-1-yl)-1,8-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 158996149 |
| Molecular Formula | C31H25Cl3F2N6O3 |
| Molecular Weight | 673.94 g/mol |
| Exact Mass | 672.10 |
| IUPAC Name | 6-chloro-7-(2,3-dichloro-4,5-difluoro-6-hydroxyphenyl)-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-2-oxo-4-(4-prop-2-enoylpiperazin-1-yl)-1,8-naphthyridine-3-carbonitrile |
| SMILES | C=CC(=O)N1CCN(c2c(C#N)c(=O)n(-c3c(C)ccnc3C(C)C)c3nc(-c4c(O)c(F)c(F)c(Cl)c4Cl)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C31H25Cl3F2N6O3/c1-5-19(43)40-8-10-41(11-9-40)28-16-12-18(32)26(20-21(33)22(34)23(35)24(36)29(20)44)39-30(16)42(31(45)17(28)13-37)27-15(4)6-7-38-25(27)14(2)3/h5-7,12,14,44H,1,8-11H2,2-4H3 |
| InChIKey | GDHHDXCVMYHYQU-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.94 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|