C65H49ClIN9 — CID 158996175
3-(2-chloro-4-pyridinyl)-5-(1-methylpyrazol-4-yl)-1-tritylindazole;3-iodo-5-(1-methylpyrazol-4-yl)-1-tritylindazole (PubChem CID 158996175) has the molecular formula C65H49ClIN9 and a molecular weight of 1118.53 g/mol. Its IUPAC name is 3-(2-chloro-4-pyridinyl)-5-(1-methylpyrazol-4-yl)-1-tritylindazole;3-iodo-5-(1-methylpyrazol-4-yl)-1-tritylindazole.
| Compound Name | 3-(2-chloro-4-pyridinyl)-5-(1-methylpyrazol-4-yl)-1-tritylindazole;3-iodo-5-(1-methylpyrazol-4-yl)-1-tritylindazole |
|---|---|
| PubChem CID | 158996175 |
| Molecular Formula | C65H49ClIN9 |
| Molecular Weight | 1118.53 g/mol |
| Exact Mass | 1117.28 |
| IUPAC Name | 3-(2-chloro-4-pyridinyl)-5-(1-methylpyrazol-4-yl)-1-tritylindazole;3-iodo-5-(1-methylpyrazol-4-yl)-1-tritylindazole |
| SMILES | Cn1cc(-c2ccc3c(c2)c(-c2ccnc(Cl)c2)nn3C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1.Cn1cc(-c2ccc3c(c2)c(I)nn3C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C35H26ClN5.C30H23IN4/c1-40-24-27(23-38-40)25-17-18-32-31(21-25)34(26-19-20-37-33(36)22-26)39-41(32)35(28-11-5-2-6-12-28,29-13-7-3-8-14-29)30-15-9-4-10-16-30;1-34-21-23(20-32-34)22-17-18-28-27(19-22)29(31)33-35(28)30(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-24H,1H3;2-21H,1H3 |
| InChIKey | JQTOFEOEPJDHTL-UHFFFAOYSA-N |
| XLogP | 14.87 |
| TPSA | 84.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1118.53 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|