About 2-(1-adamantyl)-3,4-bis(trifluoromethyl)phosphete
2-(1-adamantyl)-3,4-bis(trifluoromethyl)phosphete (PubChem CID 15899637) has the molecular formula C15H15F6P
and a molecular weight of 340.25 g/mol. Its IUPAC name is 2-(1-adamantyl)-3,4-bis(trifluoromethyl)phosphete.
Molecular Properties
| Compound Name | 2-(1-adamantyl)-3,4-bis(trifluoromethyl)phosphete |
| PubChem CID | 15899637 |
| Molecular Formula | C15H15F6P |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-(1-adamantyl)-3,4-bis(trifluoromethyl)phosphete |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)C(C23CC4CC(CC(C4)C2)C3)=P1 |
| InChI | InChI=1S/C15H15F6P/c16-14(17,18)10-11(22-12(10)15(19,20)21)13-4-7-1-8(5-13)3-9(2-7)6-13/h7-9H,1-6H2 |
| InChIKey | ZAHXNQVVRIAISY-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantyl)-3,4-bis(trifluoromethyl)phosphete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)-3,4-bis(trifluoromethyl)phosphete?
The IUPAC name of 2-(1-adamantyl)-3,4-bis(trifluoromethyl)phosphete (CID 15899637) is 2-(1-adamantyl)-3,4-bis(trifluoromethyl)phosphete.
What is the SMILES notation for 2-(1-adamantyl)-3,4-bis(trifluoromethyl)phosphete?
The canonical SMILES for 2-(1-adamantyl)-3,4-bis(trifluoromethyl)phosphete is FC(F)(F)C1=C(C(F)(F)F)C(C23CC4CC(CC(C4)C2)C3)=P1.
What is the InChIKey of 2-(1-adamantyl)-3,4-bis(trifluoromethyl)phosphete?
The InChIKey is ZAHXNQVVRIAISY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F6P/c16-14(17,18)10-11(22-12(10)15(19,20)21)13-4-7-1-8(5-13)3-9(2-7)6-13/h7-9H,1-6H2.
What are the key properties of 2-(1-adamantyl)-3,4-bis(trifluoromethyl)phosphete?
2-(1-adamantyl)-3,4-bis(trifluoromethyl)phosphete has a molecular weight of 340.25 g/mol, XLogP of 5.71, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)-3,4-bis(trifluoromethyl)phosphete is sourced from PubChem (CID 15899637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).