About 4-bromo-3,5-dimethylphenol;3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol
4-bromo-3,5-dimethylphenol;3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol (PubChem CID 158996885) has the molecular formula C23H22BrF3O2
and a molecular weight of 467.33 g/mol. Its IUPAC name is 4-bromo-3,5-dimethylphenol;3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol.
Molecular Properties
| Compound Name | 4-bromo-3,5-dimethylphenol;3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol |
| PubChem CID | 158996885 |
| Molecular Formula | C23H22BrF3O2 |
| Molecular Weight | 467.33 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 4-bromo-3,5-dimethylphenol;3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol |
| SMILES | Cc1cc(O)cc(C)c1-c1ccc(C(F)(F)F)cc1.Cc1cc(O)cc(C)c1Br |
| InChI | InChI=1S/C15H13F3O.C8H9BrO/c1-9-7-13(19)8-10(2)14(9)11-3-5-12(6-4-11)15(16,17)18;1-5-3-7(10)4-6(2)8(5)9/h3-8,19H,1-2H3;3-4,10H,1-2H3 |
| InChIKey | JQVQSVWHLHYJJH-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.33 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-3,5-dimethylphenol;3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3,5-dimethylphenol;3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol?
The IUPAC name of 4-bromo-3,5-dimethylphenol;3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol (CID 158996885) is 4-bromo-3,5-dimethylphenol;3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol.
What is the SMILES notation for 4-bromo-3,5-dimethylphenol;3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol?
The canonical SMILES for 4-bromo-3,5-dimethylphenol;3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol is Cc1cc(O)cc(C)c1-c1ccc(C(F)(F)F)cc1.Cc1cc(O)cc(C)c1Br.
What is the InChIKey of 4-bromo-3,5-dimethylphenol;3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol?
The InChIKey is JQVQSVWHLHYJJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3O.C8H9BrO/c1-9-7-13(19)8-10(2)14(9)11-3-5-12(6-4-11)15(16,17)18;1-5-3-7(10)4-6(2)8(5)9/h3-8,19H,1-2H3;3-4,10H,1-2H3.
What are the key properties of 4-bromo-3,5-dimethylphenol;3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol?
4-bromo-3,5-dimethylphenol;3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol has a molecular weight of 467.33 g/mol, XLogP of 7.47, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3,5-dimethylphenol;3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenol is sourced from PubChem (CID 158996885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).