C36H29N15O8 — CID 158997442
4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzoic acid;(4-nitrophenyl) 4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzoate (PubChem CID 158997442) has the molecular formula C36H29N15O8 and a molecular weight of 799.73 g/mol. Its IUPAC name is 4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzoic acid;(4-nitrophenyl) 4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzoate.
| Compound Name | 4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzoic acid;(4-nitrophenyl) 4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzoate |
|---|---|
| PubChem CID | 158997442 |
| Molecular Formula | C36H29N15O8 |
| Molecular Weight | 799.73 g/mol |
| Exact Mass | 799.23 |
| IUPAC Name | 4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzoic acid;(4-nitrophenyl) 4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzoate |
| SMILES | Nc1nc(N)c2nc(CN(C=O)c3ccc(C(=O)O)cc3)cnc2n1.Nc1nc(N)c2nc(CN(C=O)c3ccc(C(=O)Oc4ccc([N+](=O)[O-])cc4)cc3)cnc2n1 |
| InChI | InChI=1S/C21H16N8O5.C15H13N7O3/c22-18-17-19(27-21(23)26-18)24-9-13(25-17)10-28(11-30)14-3-1-12(2-4-14)20(31)34-16-7-5-15(6-8-16)29(32)33;16-12-11-13(21-15(17)20-12)18-5-9(19-11)6-22(7-23)10-3-1-8(2-4-10)14(24)25/h1-9,11H,10H2,(H4,22,23,24,26,27);1-5,7H,6H2,(H,24,25)(H4,16,17,18,20,21) |
| InChIKey | JQXJJKBPDVDGQK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 354.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.73 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|