C40H49NO6 — CID 159001060
[(6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] 4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxylate (PubChem CID 159001060) has the molecular formula C40H49NO6 and a molecular weight of 639.83 g/mol. Its IUPAC name is [(6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] 4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxylate.
| Compound Name | [(6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] 4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 159001060 |
| Molecular Formula | C40H49NO6 |
| Molecular Weight | 639.83 g/mol |
| Exact Mass | 639.36 |
| IUPAC Name | [(6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] 4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxylate |
| SMILES | CCCCCCC(C)(C)c1cc(OC(=O)c2cc3cc4c5c(c3oc2=O)CCCN5CCC4)c2c(c1)OC(C)(C)[C@@H]1CCC(=O)C[C@@H]21 |
| InChI | InChI=1S/C40H49NO6/c1-6-7-8-9-16-39(2,3)26-21-32(34-29-23-27(42)14-15-31(29)40(4,5)47-33(34)22-26)45-37(43)30-20-25-19-24-12-10-17-41-18-11-13-28(35(24)41)36(25)46-38(30)44/h19-22,29,31H,6-18,23H2,1-5H3/t29-,31-/m1/s1 |
| InChIKey | JRIMWAYVFMRJMG-BVRKHOPBSA-N |
| XLogP | 8.58 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.83 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|