C42H30N2S2Si — CID 159001337
7-N-dibenzothiophen-3-yl-2-N,2-N-diphenyl-7-N-(3-silylphenyl)dibenzothiophene-2,7-diamine (PubChem CID 159001337) has the molecular formula C42H30N2S2Si and a molecular weight of 654.94 g/mol. Its IUPAC name is 7-N-dibenzothiophen-3-yl-2-N,2-N-diphenyl-7-N-(3-silylphenyl)dibenzothiophene-2,7-diamine.
| Compound Name | 7-N-dibenzothiophen-3-yl-2-N,2-N-diphenyl-7-N-(3-silylphenyl)dibenzothiophene-2,7-diamine |
|---|---|
| PubChem CID | 159001337 |
| Molecular Formula | C42H30N2S2Si |
| Molecular Weight | 654.94 g/mol |
| Exact Mass | 654.16 |
| IUPAC Name | 7-N-dibenzothiophen-3-yl-2-N,2-N-diphenyl-7-N-(3-silylphenyl)dibenzothiophene-2,7-diamine |
| SMILES | [SiH3]c1cccc(N(c2ccc3c(c2)sc2ccccc23)c2ccc3c(c2)sc2ccc(N(c4ccccc4)c4ccccc4)cc23)c1 |
| InChI | InChI=1S/C42H30N2S2Si/c47-34-15-9-14-30(24-34)44(32-18-21-36-35-16-7-8-17-39(35)45-41(36)26-32)33-19-22-37-38-25-31(20-23-40(38)46-42(37)27-33)43(28-10-3-1-4-11-28)29-12-5-2-6-13-29/h1-27H,47H3 |
| InChIKey | NXULLVUCPLKSKA-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.94 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|