About pyrrole-2,5-dione;sulfurous acid
pyrrole-2,5-dione;sulfurous acid (PubChem CID 159001370) has the molecular formula C4H5NO5S
and a molecular weight of 179.15 g/mol. Its IUPAC name is pyrrole-2,5-dione;sulfurous acid.
Molecular Properties
| Compound Name | pyrrole-2,5-dione;sulfurous acid |
| PubChem CID | 159001370 |
| Molecular Formula | C4H5NO5S |
| Molecular Weight | 179.15 g/mol |
| Exact Mass | 178.99 |
| IUPAC Name | pyrrole-2,5-dione;sulfurous acid |
| SMILES | O=C1C=CC(=O)N1.O=S(O)O |
| InChI | InChI=1S/C4H3NO2.H2O3S/c6-3-1-2-4(7)5-3;1-4(2)3/h1-2H,(H,5,6,7);(H2,1,2,3) |
| InChIKey | JRJIHFNILSNFIO-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.15 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze pyrrole-2,5-dione;sulfurous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrole-2,5-dione;sulfurous acid?
The IUPAC name of pyrrole-2,5-dione;sulfurous acid (CID 159001370) is pyrrole-2,5-dione;sulfurous acid.
What is the SMILES notation for pyrrole-2,5-dione;sulfurous acid?
The canonical SMILES for pyrrole-2,5-dione;sulfurous acid is O=C1C=CC(=O)N1.O=S(O)O.
What is the InChIKey of pyrrole-2,5-dione;sulfurous acid?
The InChIKey is JRJIHFNILSNFIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2.H2O3S/c6-3-1-2-4(7)5-3;1-4(2)3/h1-2H,(H,5,6,7);(H2,1,2,3).
What are the key properties of pyrrole-2,5-dione;sulfurous acid?
pyrrole-2,5-dione;sulfurous acid has a molecular weight of 179.15 g/mol, XLogP of -1.12, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrole-2,5-dione;sulfurous acid is sourced from PubChem (CID 159001370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).