C11H21NO — CID 159001557
4-methyl-1-[(2S,4S)-4-methylpyrrolidin-2-yl]pentan-1-one (PubChem CID 159001557) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 4-methyl-1-[(2S,4S)-4-methylpyrrolidin-2-yl]pentan-1-one.
| Compound Name | 4-methyl-1-[(2S,4S)-4-methylpyrrolidin-2-yl]pentan-1-one |
|---|---|
| PubChem CID | 159001557 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 4-methyl-1-[(2S,4S)-4-methylpyrrolidin-2-yl]pentan-1-one |
| SMILES | CC(C)CCC(=O)[C@@H]1C[C@H](C)CN1 |
| InChI | InChI=1S/C11H21NO/c1-8(2)4-5-11(13)10-6-9(3)7-12-10/h8-10,12H,4-7H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | DIPLQUABCBEUHK-UWVGGRQHSA-N |
| XLogP | 1.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |