C28H42ClN3O3 — CID 159002531
(6aR,9R,10aR)-3-(8-chloro-2-methyloctan-2-yl)-9-[[4-(hydroxymethyl)triazol-1-yl]methyl]-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol (PubChem CID 159002531) has the molecular formula C28H42ClN3O3 and a molecular weight of 504.12 g/mol. Its IUPAC name is (6aR,9R,10aR)-3-(8-chloro-2-methyloctan-2-yl)-9-[[4-(hydroxymethyl)triazol-1-yl]methyl]-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol.
| Compound Name | (6aR,9R,10aR)-3-(8-chloro-2-methyloctan-2-yl)-9-[[4-(hydroxymethyl)triazol-1-yl]methyl]-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 159002531 |
| Molecular Formula | C28H42ClN3O3 |
| Molecular Weight | 504.12 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | (6aR,9R,10aR)-3-(8-chloro-2-methyloctan-2-yl)-9-[[4-(hydroxymethyl)triazol-1-yl]methyl]-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol |
| SMILES | CC(C)(CCCCCCCl)c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CC[C@@H](Cn3cc(CO)nn3)C[C@@H]21 |
| InChI | InChI=1S/C28H42ClN3O3/c1-27(2,11-7-5-6-8-12-29)20-14-24(34)26-22-13-19(16-32-17-21(18-33)30-31-32)9-10-23(22)28(3,4)35-25(26)15-20/h14-15,17,19,22-23,33-34H,5-13,16,18H2,1-4H3/t19-,22-,23-/m1/s1 |
| InChIKey | JRMYMQKIKBIVDX-UEVCKROQSA-N |
| XLogP | 6.31 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.12 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|