C22H30Cl2N6O5 — CID 159003981
2-amino-6-chloro-4-methylpyridine-3-carboxamide;7-chloro-5-methyl-3H-pyrido[2,3-d]pyrimidin-4-one;diethoxymethoxyethane (PubChem CID 159003981) has the molecular formula C22H30Cl2N6O5 and a molecular weight of 529.43 g/mol. Its IUPAC name is 2-amino-6-chloro-4-methylpyridine-3-carboxamide;7-chloro-5-methyl-3H-pyrido[2,3-d]pyrimidin-4-one;diethoxymethoxyethane.
| Compound Name | 2-amino-6-chloro-4-methylpyridine-3-carboxamide;7-chloro-5-methyl-3H-pyrido[2,3-d]pyrimidin-4-one;diethoxymethoxyethane |
|---|---|
| PubChem CID | 159003981 |
| Molecular Formula | C22H30Cl2N6O5 |
| Molecular Weight | 529.43 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 2-amino-6-chloro-4-methylpyridine-3-carboxamide;7-chloro-5-methyl-3H-pyrido[2,3-d]pyrimidin-4-one;diethoxymethoxyethane |
| SMILES | CCOC(OCC)OCC.Cc1cc(Cl)nc(N)c1C(N)=O.Cc1cc(Cl)nc2nc[nH]c(=O)c12 |
| InChI | InChI=1S/C8H6ClN3O.C7H8ClN3O.C7H16O3/c1-4-2-5(9)12-7-6(4)8(13)11-3-10-7;1-3-2-4(8)11-6(9)5(3)7(10)12;1-4-8-7(9-5-2)10-6-3/h2-3H,1H3,(H,10,11,12,13);2H,1H3,(H2,9,11)(H2,10,12);7H,4-6H2,1-3H3 |
| InChIKey | JRRMEPRFDHBDFK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 168.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|