C20H17FN4O2S — CID 159004109
1-N-[5-(1-fluoroisoquinolin-6-yl)-1,3-oxazol-2-yl]-3-N-(methyl-methylidene-oxo-λ6-sulfanyl)benzene-1,3-diamine (PubChem CID 159004109) has the molecular formula C20H17FN4O2S and a molecular weight of 396.45 g/mol. Its IUPAC name is 1-N-[5-(1-fluoroisoquinolin-6-yl)-1,3-oxazol-2-yl]-3-N-(methyl-methylidene-oxo-λ6-sulfanyl)benzene-1,3-diamine.
| Compound Name | 1-N-[5-(1-fluoroisoquinolin-6-yl)-1,3-oxazol-2-yl]-3-N-(methyl-methylidene-oxo-λ6-sulfanyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 159004109 |
| Molecular Formula | C20H17FN4O2S |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 1-N-[5-(1-fluoroisoquinolin-6-yl)-1,3-oxazol-2-yl]-3-N-(methyl-methylidene-oxo-λ6-sulfanyl)benzene-1,3-diamine |
| SMILES | C=S(C)(=O)Nc1cccc(Nc2ncc(-c3ccc4c(F)nccc4c3)o2)c1 |
| InChI | InChI=1S/C20H17FN4O2S/c1-28(2,26)25-16-5-3-4-15(11-16)24-20-23-12-18(27-20)14-6-7-17-13(10-14)8-9-22-19(17)21/h3-12H,1H2,2H3,(H,23,24)(H,25,26) |
| InChIKey | QLWZWGSKCOHMBW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|