C35H26N6O3 — CID 159004372
1-[3-(1,2-oxazol-3-yl)phenyl]benzimidazole-5-carbaldehyde;[1-(3-pyrrol-1-ylphenyl)benzimidazol-5-yl]methanol (PubChem CID 159004372) has the molecular formula C35H26N6O3 and a molecular weight of 578.63 g/mol. Its IUPAC name is 1-[3-(1,2-oxazol-3-yl)phenyl]benzimidazole-5-carbaldehyde;[1-(3-pyrrol-1-ylphenyl)benzimidazol-5-yl]methanol.
| Compound Name | 1-[3-(1,2-oxazol-3-yl)phenyl]benzimidazole-5-carbaldehyde;[1-(3-pyrrol-1-ylphenyl)benzimidazol-5-yl]methanol |
|---|---|
| PubChem CID | 159004372 |
| Molecular Formula | C35H26N6O3 |
| Molecular Weight | 578.63 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | 1-[3-(1,2-oxazol-3-yl)phenyl]benzimidazole-5-carbaldehyde;[1-(3-pyrrol-1-ylphenyl)benzimidazol-5-yl]methanol |
| SMILES | O=Cc1ccc2c(c1)ncn2-c1cccc(-c2ccon2)c1.OCc1ccc2c(c1)ncn2-c1cccc(-n2cccc2)c1 |
| InChI | InChI=1S/C18H15N3O.C17H11N3O2/c22-12-14-6-7-18-17(10-14)19-13-21(18)16-5-3-4-15(11-16)20-8-1-2-9-20;21-10-12-4-5-17-16(8-12)18-11-20(17)14-3-1-2-13(9-14)15-6-7-22-19-15/h1-11,13,22H,12H2;1-11H |
| InChIKey | JRSSAAOBURVADA-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 103.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.63 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|