About 1-methylsulfonylpropan-2-one;3-oxobutanenitrile;pentane-2,4-dione
1-methylsulfonylpropan-2-one;3-oxobutanenitrile;pentane-2,4-dione (PubChem CID 159005059) has the molecular formula C13H21NO6S
and a molecular weight of 319.38 g/mol. Its IUPAC name is 1-methylsulfonylpropan-2-one;3-oxobutanenitrile;pentane-2,4-dione.
Molecular Properties
| Compound Name | 1-methylsulfonylpropan-2-one;3-oxobutanenitrile;pentane-2,4-dione |
| PubChem CID | 159005059 |
| Molecular Formula | C13H21NO6S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-methylsulfonylpropan-2-one;3-oxobutanenitrile;pentane-2,4-dione |
| SMILES | CC(=O)CC#N.CC(=O)CC(C)=O.CC(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C5H8O2.C4H5NO.C4H8O3S/c1-4(6)3-5(2)7;1-4(6)2-3-5;1-4(5)3-8(2,6)7/h3H2,1-2H3;2H2,1H3;3H2,1-2H3 |
| InChIKey | JRUWVSQMCVAIRM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 126.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-methylsulfonylpropan-2-one;3-oxobutanenitrile;pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfonylpropan-2-one;3-oxobutanenitrile;pentane-2,4-dione?
The IUPAC name of 1-methylsulfonylpropan-2-one;3-oxobutanenitrile;pentane-2,4-dione (CID 159005059) is 1-methylsulfonylpropan-2-one;3-oxobutanenitrile;pentane-2,4-dione.
What is the SMILES notation for 1-methylsulfonylpropan-2-one;3-oxobutanenitrile;pentane-2,4-dione?
The canonical SMILES for 1-methylsulfonylpropan-2-one;3-oxobutanenitrile;pentane-2,4-dione is CC(=O)CC#N.CC(=O)CC(C)=O.CC(=O)CS(C)(=O)=O.
What is the InChIKey of 1-methylsulfonylpropan-2-one;3-oxobutanenitrile;pentane-2,4-dione?
The InChIKey is JRUWVSQMCVAIRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C4H5NO.C4H8O3S/c1-4(6)3-5(2)7;1-4(6)2-3-5;1-4(5)3-8(2,6)7/h3H2,1-2H3;2H2,1H3;3H2,1-2H3.
What are the key properties of 1-methylsulfonylpropan-2-one;3-oxobutanenitrile;pentane-2,4-dione?
1-methylsulfonylpropan-2-one;3-oxobutanenitrile;pentane-2,4-dione has a molecular weight of 319.38 g/mol, XLogP of 0.66, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfonylpropan-2-one;3-oxobutanenitrile;pentane-2,4-dione is sourced from PubChem (CID 159005059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).