C16H23F14N3O5S — CID 159005724
3-[3-(carbonofluoridoylamino)propyl-dimethylazaniumyl]propane-1-sulfonate;2,2,3,3,5,5,6,6-octafluoro-4-(fluoromethyl)morpholine;1,1,1,2-tetrafluoroethane (PubChem CID 159005724) has the molecular formula C16H23F14N3O5S and a molecular weight of 635.41 g/mol. Its IUPAC name is 3-[3-(carbonofluoridoylamino)propyl-dimethylazaniumyl]propane-1-sulfonate;2,2,3,3,5,5,6,6-octafluoro-4-(fluoromethyl)morpholine;1,1,1,2-tetrafluoroethane.
| Compound Name | 3-[3-(carbonofluoridoylamino)propyl-dimethylazaniumyl]propane-1-sulfonate;2,2,3,3,5,5,6,6-octafluoro-4-(fluoromethyl)morpholine;1,1,1,2-tetrafluoroethane |
|---|---|
| PubChem CID | 159005724 |
| Molecular Formula | C16H23F14N3O5S |
| Molecular Weight | 635.41 g/mol |
| Exact Mass | 635.11 |
| IUPAC Name | 3-[3-(carbonofluoridoylamino)propyl-dimethylazaniumyl]propane-1-sulfonate;2,2,3,3,5,5,6,6-octafluoro-4-(fluoromethyl)morpholine;1,1,1,2-tetrafluoroethane |
| SMILES | C[N+](C)(CCCNC(=O)F)CCCS(=O)(=O)[O-].FCC(F)(F)F.FCN1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C9H19FN2O4S.C5H2F9NO.C2H2F4/c1-12(2,6-3-5-11-9(10)13)7-4-8-17(14,15)16;6-1-15-2(7,8)4(11,12)16-5(13,14)3(15,9)10;3-1-2(4,5)6/h3-8H2,1-2H3,(H-,11,13,14,15,16);1H2;1H2 |
| InChIKey | JRWXELNGBQAQBT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|