About (5R)-2,9-dimethyl-2,9-diazaspiro[4.5]decan-1-one;ethane;methane
(5R)-2,9-dimethyl-2,9-diazaspiro[4.5]decan-1-one;ethane;methane (PubChem CID 159006530) has the molecular formula C15H34N2O
and a molecular weight of 258.45 g/mol. Its IUPAC name is (5R)-2,9-dimethyl-2,9-diazaspiro[4.5]decan-1-one;ethane;methane.
Molecular Properties
| Compound Name | (5R)-2,9-dimethyl-2,9-diazaspiro[4.5]decan-1-one;ethane;methane |
| PubChem CID | 159006530 |
| Molecular Formula | C15H34N2O |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.27 |
| IUPAC Name | (5R)-2,9-dimethyl-2,9-diazaspiro[4.5]decan-1-one;ethane;methane |
| SMILES | C.CC.CC.CN1CCC[C@@]2(CCN(C)C2=O)C1 |
| InChI | InChI=1S/C10H18N2O.2C2H6.CH4/c1-11-6-3-4-10(8-11)5-7-12(2)9(10)13;2*1-2;/h3-8H2,1-2H3;2*1-2H3;1H4/t10-;;;/m1.../s1 |
| InChIKey | JRZHWXGUTRKSJA-FYBBWCNBSA-N |
| XLogP | 3.25 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-2,9-dimethyl-2,9-diazaspiro[4.5]decan-1-one;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-2,9-dimethyl-2,9-diazaspiro[4.5]decan-1-one;ethane;methane?
The IUPAC name of (5R)-2,9-dimethyl-2,9-diazaspiro[4.5]decan-1-one;ethane;methane (CID 159006530) is (5R)-2,9-dimethyl-2,9-diazaspiro[4.5]decan-1-one;ethane;methane.
What is the SMILES notation for (5R)-2,9-dimethyl-2,9-diazaspiro[4.5]decan-1-one;ethane;methane?
The canonical SMILES for (5R)-2,9-dimethyl-2,9-diazaspiro[4.5]decan-1-one;ethane;methane is C.CC.CC.CN1CCC[C@@]2(CCN(C)C2=O)C1.
What is the InChIKey of (5R)-2,9-dimethyl-2,9-diazaspiro[4.5]decan-1-one;ethane;methane?
The InChIKey is JRZHWXGUTRKSJA-FYBBWCNBSA-N. The full InChI is InChI=1S/C10H18N2O.2C2H6.CH4/c1-11-6-3-4-10(8-11)5-7-12(2)9(10)13;2*1-2;/h3-8H2,1-2H3;2*1-2H3;1H4/t10-;;;/m1.../s1.
What are the key properties of (5R)-2,9-dimethyl-2,9-diazaspiro[4.5]decan-1-one;ethane;methane?
(5R)-2,9-dimethyl-2,9-diazaspiro[4.5]decan-1-one;ethane;methane has a molecular weight of 258.45 g/mol, XLogP of 3.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-2,9-dimethyl-2,9-diazaspiro[4.5]decan-1-one;ethane;methane is sourced from PubChem (CID 159006530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).