C15H16O3 — CID 159007944
3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;toluene (PubChem CID 159007944) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;toluene.
| Compound Name | 3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;toluene |
|---|---|
| PubChem CID | 159007944 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;toluene |
| SMILES | Cc1ccccc1.O=C1OC(=O)C2CCC=CC12 |
| InChI | InChI=1S/C8H8O3.C7H8/c9-7-5-3-1-2-4-6(5)8(10)11-7;1-7-5-3-2-4-6-7/h1,3,5-6H,2,4H2;2-6H,1H3 |
| InChIKey | JSDPBSDABNICNR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|