C47H50F6N2O2S — CID 159008193
4-[4-[2-[4-(3,4-dimethylphenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-1,2-dimethylbenzene;2,3,5,6-tetramethylpyrazine;2,3,4,5-tetramethylthiophene (PubChem CID 159008193) has the molecular formula C47H50F6N2O2S and a molecular weight of 820.98 g/mol. Its IUPAC name is 4-[4-[2-[4-(3,4-dimethylphenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-1,2-dimethylbenzene;2,3,5,6-tetramethylpyrazine;2,3,4,5-tetramethylthiophene.
| Compound Name | 4-[4-[2-[4-(3,4-dimethylphenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-1,2-dimethylbenzene;2,3,5,6-tetramethylpyrazine;2,3,4,5-tetramethylthiophene |
|---|---|
| PubChem CID | 159008193 |
| Molecular Formula | C47H50F6N2O2S |
| Molecular Weight | 820.98 g/mol |
| Exact Mass | 820.35 |
| IUPAC Name | 4-[4-[2-[4-(3,4-dimethylphenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-1,2-dimethylbenzene;2,3,5,6-tetramethylpyrazine;2,3,4,5-tetramethylthiophene |
| SMILES | Cc1ccc(Oc2ccc(C(c3ccc(Oc4ccc(C)c(C)c4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1C.Cc1nc(C)c(C)nc1C.Cc1sc(C)c(C)c1C |
| InChI | InChI=1S/C31H26F6O2.C8H12N2.C8H12S/c1-19-5-11-27(17-21(19)3)38-25-13-7-23(8-14-25)29(30(32,33)34,31(35,36)37)24-9-15-26(16-10-24)39-28-12-6-20(2)22(4)18-28;1-5-6(2)10-8(4)7(3)9-5;1-5-6(2)8(4)9-7(5)3/h5-18H,1-4H3;1-4H3;1-4H3 |
| InChIKey | JSEKCGONHCCSSQ-UHFFFAOYSA-N |
| XLogP | 14.61 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.98 |
| LogP ≤ 5 | 14.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |