About [(2S)-4,4-difluoro-1-(oxetan-3-yl)pyrrolidin-2-yl]methanol;oxolane
[(2S)-4,4-difluoro-1-(oxetan-3-yl)pyrrolidin-2-yl]methanol;oxolane (PubChem CID 159008508) has the molecular formula C12H21F2NO3
and a molecular weight of 265.30 g/mol. Its IUPAC name is [(2S)-4,4-difluoro-1-(oxetan-3-yl)pyrrolidin-2-yl]methanol;oxolane.
Molecular Properties
| Compound Name | [(2S)-4,4-difluoro-1-(oxetan-3-yl)pyrrolidin-2-yl]methanol;oxolane |
| PubChem CID | 159008508 |
| Molecular Formula | C12H21F2NO3 |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | [(2S)-4,4-difluoro-1-(oxetan-3-yl)pyrrolidin-2-yl]methanol;oxolane |
| SMILES | C1CCOC1.OC[C@@H]1CC(F)(F)CN1C1COC1 |
| InChI | InChI=1S/C8H13F2NO2.C4H8O/c9-8(10)1-6(2-12)11(5-8)7-3-13-4-7;1-2-4-5-3-1/h6-7,12H,1-5H2;1-4H2/t6-;/m0./s1 |
| InChIKey | JSFITWMKUBNKIU-RGMNGODLSA-N |
| XLogP | 0.88 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S)-4,4-difluoro-1-(oxetan-3-yl)pyrrolidin-2-yl]methanol;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-4,4-difluoro-1-(oxetan-3-yl)pyrrolidin-2-yl]methanol;oxolane?
The IUPAC name of [(2S)-4,4-difluoro-1-(oxetan-3-yl)pyrrolidin-2-yl]methanol;oxolane (CID 159008508) is [(2S)-4,4-difluoro-1-(oxetan-3-yl)pyrrolidin-2-yl]methanol;oxolane.
What is the SMILES notation for [(2S)-4,4-difluoro-1-(oxetan-3-yl)pyrrolidin-2-yl]methanol;oxolane?
The canonical SMILES for [(2S)-4,4-difluoro-1-(oxetan-3-yl)pyrrolidin-2-yl]methanol;oxolane is C1CCOC1.OC[C@@H]1CC(F)(F)CN1C1COC1.
What is the InChIKey of [(2S)-4,4-difluoro-1-(oxetan-3-yl)pyrrolidin-2-yl]methanol;oxolane?
The InChIKey is JSFITWMKUBNKIU-RGMNGODLSA-N. The full InChI is InChI=1S/C8H13F2NO2.C4H8O/c9-8(10)1-6(2-12)11(5-8)7-3-13-4-7;1-2-4-5-3-1/h6-7,12H,1-5H2;1-4H2/t6-;/m0./s1.
What are the key properties of [(2S)-4,4-difluoro-1-(oxetan-3-yl)pyrrolidin-2-yl]methanol;oxolane?
[(2S)-4,4-difluoro-1-(oxetan-3-yl)pyrrolidin-2-yl]methanol;oxolane has a molecular weight of 265.30 g/mol, XLogP of 0.88, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-4,4-difluoro-1-(oxetan-3-yl)pyrrolidin-2-yl]methanol;oxolane is sourced from PubChem (CID 159008508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).