C12H10N2O6 — CID 159009419
2-[(2,4,6-trihydroxyphenyl)diazenyl]benzene-1,3,5-triol (PubChem CID 159009419) has the molecular formula C12H10N2O6 and a molecular weight of 278.22 g/mol. Its IUPAC name is 2-[(2,4,6-trihydroxyphenyl)diazenyl]benzene-1,3,5-triol.
| Compound Name | 2-[(2,4,6-trihydroxyphenyl)diazenyl]benzene-1,3,5-triol |
|---|---|
| PubChem CID | 159009419 |
| Molecular Formula | C12H10N2O6 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-[(2,4,6-trihydroxyphenyl)diazenyl]benzene-1,3,5-triol |
| SMILES | Oc1cc(O)c(/N=N/c2c(O)cc(O)cc2O)c(O)c1 |
| InChI | InChI=1S/C12H10N2O6/c15-5-1-7(17)11(8(18)2-5)13-14-12-9(19)3-6(16)4-10(12)20/h1-4,15-20H/b14-13+ |
| InChIKey | BANPNGUMLJQQEF-BUHFOSPRSA-N |
| XLogP | 2.34 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|