C26H35N5O6S — CID 159009708
5-[3-[[(1R,2R)-1-(3,3-dimethylcyclobutyl)-1-methoxypropan-2-yl]sulfonylmethyl]-5-(3-methoxyphenyl)-1,2,4-triazol-4-yl]-4,6-dimethoxypyrimidine (PubChem CID 159009708) has the molecular formula C26H35N5O6S and a molecular weight of 545.66 g/mol. Its IUPAC name is 5-[3-[[(1R,2R)-1-(3,3-dimethylcyclobutyl)-1-methoxypropan-2-yl]sulfonylmethyl]-5-(3-methoxyphenyl)-1,2,4-triazol-4-yl]-4,6-dimethoxypyrimidine.
| Compound Name | 5-[3-[[(1R,2R)-1-(3,3-dimethylcyclobutyl)-1-methoxypropan-2-yl]sulfonylmethyl]-5-(3-methoxyphenyl)-1,2,4-triazol-4-yl]-4,6-dimethoxypyrimidine |
|---|---|
| PubChem CID | 159009708 |
| Molecular Formula | C26H35N5O6S |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | 5-[3-[[(1R,2R)-1-(3,3-dimethylcyclobutyl)-1-methoxypropan-2-yl]sulfonylmethyl]-5-(3-methoxyphenyl)-1,2,4-triazol-4-yl]-4,6-dimethoxypyrimidine |
| SMILES | COc1cccc(-c2nnc(CS(=O)(=O)[C@H](C)[C@H](OC)C3CC(C)(C)C3)n2-c2c(OC)ncnc2OC)c1 |
| InChI | InChI=1S/C26H35N5O6S/c1-16(22(35-5)18-12-26(2,3)13-18)38(32,33)14-20-29-30-23(17-9-8-10-19(11-17)34-4)31(20)21-24(36-6)27-15-28-25(21)37-7/h8-11,15-16,18,22H,12-14H2,1-7H3/t16-,22+/m1/s1 |
| InChIKey | LQQLJAMGJQEIHZ-ZHRRBRCNSA-N |
| XLogP | 3.50 |
| TPSA | 127.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |