About aniline;2-chloro-3-nitropyridine;3-nitro-N-phenylpyridin-2-amine
aniline;2-chloro-3-nitropyridine;3-nitro-N-phenylpyridin-2-amine (PubChem CID 159011390) has the molecular formula C22H19ClN6O4
and a molecular weight of 466.89 g/mol. Its IUPAC name is aniline;2-chloro-3-nitropyridine;3-nitro-N-phenylpyridin-2-amine.
Molecular Properties
| Compound Name | aniline;2-chloro-3-nitropyridine;3-nitro-N-phenylpyridin-2-amine |
| PubChem CID | 159011390 |
| Molecular Formula | C22H19ClN6O4 |
| Molecular Weight | 466.89 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | aniline;2-chloro-3-nitropyridine;3-nitro-N-phenylpyridin-2-amine |
| SMILES | Nc1ccccc1.O=[N+]([O-])c1cccnc1Cl.O=[N+]([O-])c1cccnc1Nc1ccccc1 |
| InChI | InChI=1S/C11H9N3O2.C6H7N.C5H3ClN2O2/c15-14(16)10-7-4-8-12-11(10)13-9-5-2-1-3-6-9;7-6-4-2-1-3-5-6;6-5-4(8(9)10)2-1-3-7-5/h1-8H,(H,12,13);1-5H,7H2;1-3H |
| InChIKey | JSNMEGGHWXMLIA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.89 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze aniline;2-chloro-3-nitropyridine;3-nitro-N-phenylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;2-chloro-3-nitropyridine;3-nitro-N-phenylpyridin-2-amine?
The IUPAC name of aniline;2-chloro-3-nitropyridine;3-nitro-N-phenylpyridin-2-amine (CID 159011390) is aniline;2-chloro-3-nitropyridine;3-nitro-N-phenylpyridin-2-amine.
What is the SMILES notation for aniline;2-chloro-3-nitropyridine;3-nitro-N-phenylpyridin-2-amine?
The canonical SMILES for aniline;2-chloro-3-nitropyridine;3-nitro-N-phenylpyridin-2-amine is Nc1ccccc1.O=[N+]([O-])c1cccnc1Cl.O=[N+]([O-])c1cccnc1Nc1ccccc1.
What is the InChIKey of aniline;2-chloro-3-nitropyridine;3-nitro-N-phenylpyridin-2-amine?
The InChIKey is JSNMEGGHWXMLIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O2.C6H7N.C5H3ClN2O2/c15-14(16)10-7-4-8-12-11(10)13-9-5-2-1-3-6-9;7-6-4-2-1-3-5-6;6-5-4(8(9)10)2-1-3-7-5/h1-8H,(H,12,13);1-5H,7H2;1-3H.
What are the key properties of aniline;2-chloro-3-nitropyridine;3-nitro-N-phenylpyridin-2-amine?
aniline;2-chloro-3-nitropyridine;3-nitro-N-phenylpyridin-2-amine has a molecular weight of 466.89 g/mol, XLogP of 5.65, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;2-chloro-3-nitropyridine;3-nitro-N-phenylpyridin-2-amine is sourced from PubChem (CID 159011390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).