About dichloro-methyl-(3,3,3-trifluoropropyl)silane
dichloro-methyl-(3,3,3-trifluoropropyl)silane (PubChem CID 159011444) has the molecular formula C8H14Cl4F6Si2
and a molecular weight of 422.17 g/mol. Its IUPAC name is dichloro-methyl-(3,3,3-trifluoropropyl)silane.
Molecular Properties
| Compound Name | dichloro-methyl-(3,3,3-trifluoropropyl)silane |
| PubChem CID | 159011444 |
| Molecular Formula | C8H14Cl4F6Si2 |
| Molecular Weight | 422.17 g/mol |
| Exact Mass | 419.93 |
| IUPAC Name | dichloro-methyl-(3,3,3-trifluoropropyl)silane |
| SMILES | C[Si](Cl)(Cl)CCC(F)(F)F.C[Si](Cl)(Cl)CCC(F)(F)F |
| InChI | InChI=1S/2C4H7Cl2F3Si/c2*1-10(5,6)3-2-4(7,8)9/h2*2-3H2,1H3 |
| InChIKey | JSNQZWSEJFNHOE-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.17 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dichloro-methyl-(3,3,3-trifluoropropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-methyl-(3,3,3-trifluoropropyl)silane?
The IUPAC name of dichloro-methyl-(3,3,3-trifluoropropyl)silane (CID 159011444) is dichloro-methyl-(3,3,3-trifluoropropyl)silane.
What is the SMILES notation for dichloro-methyl-(3,3,3-trifluoropropyl)silane?
The canonical SMILES for dichloro-methyl-(3,3,3-trifluoropropyl)silane is C[Si](Cl)(Cl)CCC(F)(F)F.C[Si](Cl)(Cl)CCC(F)(F)F.
What is the InChIKey of dichloro-methyl-(3,3,3-trifluoropropyl)silane?
The InChIKey is JSNQZWSEJFNHOE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H7Cl2F3Si/c2*1-10(5,6)3-2-4(7,8)9/h2*2-3H2,1H3.
What are the key properties of dichloro-methyl-(3,3,3-trifluoropropyl)silane?
dichloro-methyl-(3,3,3-trifluoropropyl)silane has a molecular weight of 422.17 g/mol, XLogP of 6.98, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-methyl-(3,3,3-trifluoropropyl)silane is sourced from PubChem (CID 159011444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).