C26H24N2O4S — CID 159011476
7-(2,3-dihydro-1H-isoindol-5-ylmethylsulfonyl)-2-(1-phenylethyl)-4H-isoquinoline-1,3-dione (PubChem CID 159011476) has the molecular formula C26H24N2O4S and a molecular weight of 460.56 g/mol. Its IUPAC name is 7-(2,3-dihydro-1H-isoindol-5-ylmethylsulfonyl)-2-(1-phenylethyl)-4H-isoquinoline-1,3-dione.
| Compound Name | 7-(2,3-dihydro-1H-isoindol-5-ylmethylsulfonyl)-2-(1-phenylethyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 159011476 |
| Molecular Formula | C26H24N2O4S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 7-(2,3-dihydro-1H-isoindol-5-ylmethylsulfonyl)-2-(1-phenylethyl)-4H-isoquinoline-1,3-dione |
| SMILES | CC(c1ccccc1)N1C(=O)Cc2ccc(S(=O)(=O)Cc3ccc4c(c3)CNC4)cc2C1=O |
| InChI | InChI=1S/C26H24N2O4S/c1-17(19-5-3-2-4-6-19)28-25(29)12-20-9-10-23(13-24(20)26(28)30)33(31,32)16-18-7-8-21-14-27-15-22(21)11-18/h2-11,13,17,27H,12,14-16H2,1H3 |
| InChIKey | JSNSXVCKOZDPND-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|