C41H20BF20I-2 — CID 159013922
1-ethyl-4-(4-propan-2-ylphenyl)iodanuidylbenzene;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 159013922) has the molecular formula C41H20BF20I-2 and a molecular weight of 1030.29 g/mol. Its IUPAC name is 1-ethyl-4-(4-propan-2-ylphenyl)iodanuidylbenzene;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-ethyl-4-(4-propan-2-ylphenyl)iodanuidylbenzene;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 159013922 |
| Molecular Formula | C41H20BF20I-2 |
| Molecular Weight | 1030.29 g/mol |
| Exact Mass | 1030.04 |
| IUPAC Name | 1-ethyl-4-(4-propan-2-ylphenyl)iodanuidylbenzene;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CCc1ccc([I-]c2ccc(C(C)C)cc2)cc1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C17H20I/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-4-14-5-9-16(10-6-14)18-17-11-7-15(8-12-17)13(2)3/h;5-13H,4H2,1-3H3/q2*-1 |
| InChIKey | CRQDHQOZBZSCJQ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1030.29 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|