About 3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]pyridine
3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]pyridine (PubChem CID 159013939) has the molecular formula C13H12BNO4S
and a molecular weight of 289.12 g/mol. Its IUPAC name is 3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]pyridine.
Molecular Properties
| Compound Name | 3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]pyridine |
| PubChem CID | 159013939 |
| Molecular Formula | C13H12BNO4S |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]pyridine |
| SMILES | O=S(=O)(Cc1ccc2c(c1)B(O)OC2)c1cccnc1 |
| InChI | InChI=1S/C13H12BNO4S/c16-14-13-6-10(3-4-11(13)8-19-14)9-20(17,18)12-2-1-5-15-7-12/h1-7,16H,8-9H2 |
| InChIKey | CRIDSNCAJOALQE-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]pyridine?
The IUPAC name of 3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]pyridine (CID 159013939) is 3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]pyridine.
What is the SMILES notation for 3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]pyridine?
The canonical SMILES for 3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]pyridine is O=S(=O)(Cc1ccc2c(c1)B(O)OC2)c1cccnc1.
What is the InChIKey of 3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]pyridine?
The InChIKey is CRIDSNCAJOALQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BNO4S/c16-14-13-6-10(3-4-11(13)8-19-14)9-20(17,18)12-2-1-5-15-7-12/h1-7,16H,8-9H2.
What are the key properties of 3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]pyridine?
3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]pyridine has a molecular weight of 289.12 g/mol, XLogP of 0.27, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methylsulfonyl]pyridine is sourced from PubChem (CID 159013939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).