C8H9F8NO4S2 — CID 159014114
4,4,5,5,6,6,7,7-octafluoro-1λ6,3λ6-dithia-2-azacycloundecane 1,1,3,3-tetraoxide (PubChem CID 159014114) has the molecular formula C8H9F8NO4S2 and a molecular weight of 399.28 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7-octafluoro-1λ6,3λ6-dithia-2-azacycloundecane 1,1,3,3-tetraoxide.
| Compound Name | 4,4,5,5,6,6,7,7-octafluoro-1λ6,3λ6-dithia-2-azacycloundecane 1,1,3,3-tetraoxide |
|---|---|
| PubChem CID | 159014114 |
| Molecular Formula | C8H9F8NO4S2 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | 4,4,5,5,6,6,7,7-octafluoro-1λ6,3λ6-dithia-2-azacycloundecane 1,1,3,3-tetraoxide |
| SMILES | O=S1(=O)CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1 |
| InChI | InChI=1S/C8H9F8NO4S2/c9-5(10)3-1-2-4-22(18,19)17-23(20,21)8(15,16)7(13,14)6(5,11)12/h17H,1-4H2 |
| InChIKey | ICIJYXKVQQMEKO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|