About 3-bromo-N,N-bis(3-bromopropyl)propan-1-amine
3-bromo-N,N-bis(3-bromopropyl)propan-1-amine (PubChem CID 15901499) has the molecular formula C9H18Br3N
and a molecular weight of 379.96 g/mol. Its IUPAC name is 3-bromo-N,N-bis(3-bromopropyl)propan-1-amine.
Molecular Properties
| Compound Name | 3-bromo-N,N-bis(3-bromopropyl)propan-1-amine |
| PubChem CID | 15901499 |
| Molecular Formula | C9H18Br3N |
| Molecular Weight | 379.96 g/mol |
| Exact Mass | 376.90 |
| IUPAC Name | 3-bromo-N,N-bis(3-bromopropyl)propan-1-amine |
| SMILES | BrCCCN(CCCBr)CCCBr |
| InChI | InChI=1S/C9H18Br3N/c10-4-1-7-13(8-2-5-11)9-3-6-12/h1-9H2 |
| InChIKey | CHECPFFWYRKRNI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.96 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-N,N-bis(3-bromopropyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N,N-bis(3-bromopropyl)propan-1-amine?
The IUPAC name of 3-bromo-N,N-bis(3-bromopropyl)propan-1-amine (CID 15901499) is 3-bromo-N,N-bis(3-bromopropyl)propan-1-amine.
What is the SMILES notation for 3-bromo-N,N-bis(3-bromopropyl)propan-1-amine?
The canonical SMILES for 3-bromo-N,N-bis(3-bromopropyl)propan-1-amine is BrCCCN(CCCBr)CCCBr.
What is the InChIKey of 3-bromo-N,N-bis(3-bromopropyl)propan-1-amine?
The InChIKey is CHECPFFWYRKRNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18Br3N/c10-4-1-7-13(8-2-5-11)9-3-6-12/h1-9H2.
What are the key properties of 3-bromo-N,N-bis(3-bromopropyl)propan-1-amine?
3-bromo-N,N-bis(3-bromopropyl)propan-1-amine has a molecular weight of 379.96 g/mol, XLogP of 3.64, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N,N-bis(3-bromopropyl)propan-1-amine is sourced from PubChem (CID 15901499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).