About acetic acid;decanoic acid
acetic acid;decanoic acid (PubChem CID 159015360) has the molecular formula C14H28O6
and a molecular weight of 292.37 g/mol. Its IUPAC name is acetic acid;decanoic acid.
Molecular Properties
| Compound Name | acetic acid;decanoic acid |
| PubChem CID | 159015360 |
| Molecular Formula | C14H28O6 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | acetic acid;decanoic acid |
| SMILES | CC(=O)O.CC(=O)O.CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C10H20O2.2C2H4O2/c1-2-3-4-5-6-7-8-9-10(11)12;2*1-2(3)4/h2-9H2,1H3,(H,11,12);2*1H3,(H,3,4) |
| InChIKey | JTACJVOALGRMKR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;decanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;decanoic acid?
The IUPAC name of acetic acid;decanoic acid (CID 159015360) is acetic acid;decanoic acid.
What is the SMILES notation for acetic acid;decanoic acid?
The canonical SMILES for acetic acid;decanoic acid is CC(=O)O.CC(=O)O.CCCCCCCCCC(=O)O.
What is the InChIKey of acetic acid;decanoic acid?
The InChIKey is JTACJVOALGRMKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.2C2H4O2/c1-2-3-4-5-6-7-8-9-10(11)12;2*1-2(3)4/h2-9H2,1H3,(H,11,12);2*1H3,(H,3,4).
What are the key properties of acetic acid;decanoic acid?
acetic acid;decanoic acid has a molecular weight of 292.37 g/mol, XLogP of 3.39, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;decanoic acid is sourced from PubChem (CID 159015360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).