About CID 159015960
CID 159015960 (PubChem CID 159015960) has the molecular formula C13H28B
and a molecular weight of 195.18 g/mol.
Molecular Properties
| Compound Name | CID 159015960 |
| PubChem CID | 159015960 |
| Molecular Formula | C13H28B |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.23 |
| IUPAC Name | — |
| SMILES | CC.CC.CC.CC1(C)C=CC=C1.[B] |
| InChI | InChI=1S/C7H10.3C2H6.B/c1-7(2)5-3-4-6-7;3*1-2;/h3-6H,1-2H3;3*1-2H3; |
| InChIKey | RRLHGICXPDQYRN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159015960 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159015960?
The IUPAC name of CID 159015960 (CID 159015960) is not available.
What is the SMILES notation for CID 159015960?
The canonical SMILES for CID 159015960 is CC.CC.CC.CC1(C)C=CC=C1.[B].
What is the InChIKey of CID 159015960?
The InChIKey is RRLHGICXPDQYRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10.3C2H6.B/c1-7(2)5-3-4-6-7;3*1-2;/h3-6H,1-2H3;3*1-2H3;.
What are the key properties of CID 159015960?
CID 159015960 has a molecular weight of 195.18 g/mol, XLogP of 4.84, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159015960 is sourced from PubChem (CID 159015960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).