C37H32N10O6S2 — CID 159016901
ethyl 3-[[2-oxo-2-(6H-pyrazolo[5,4-g][1,3]benzothiazol-2-ylamino)ethyl]amino]benzoate;methyl 3-[[2-oxo-2-(6H-pyrazolo[5,4-g][1,3]benzothiazol-2-ylamino)ethyl]amino]benzoate (PubChem CID 159016901) has the molecular formula C37H32N10O6S2 and a molecular weight of 776.86 g/mol. Its IUPAC name is ethyl 3-[[2-oxo-2-(6H-pyrazolo[5,4-g][1,3]benzothiazol-2-ylamino)ethyl]amino]benzoate;methyl 3-[[2-oxo-2-(6H-pyrazolo[5,4-g][1,3]benzothiazol-2-ylamino)ethyl]amino]benzoate.
| Compound Name | ethyl 3-[[2-oxo-2-(6H-pyrazolo[5,4-g][1,3]benzothiazol-2-ylamino)ethyl]amino]benzoate;methyl 3-[[2-oxo-2-(6H-pyrazolo[5,4-g][1,3]benzothiazol-2-ylamino)ethyl]amino]benzoate |
|---|---|
| PubChem CID | 159016901 |
| Molecular Formula | C37H32N10O6S2 |
| Molecular Weight | 776.86 g/mol |
| Exact Mass | 776.19 |
| IUPAC Name | ethyl 3-[[2-oxo-2-(6H-pyrazolo[5,4-g][1,3]benzothiazol-2-ylamino)ethyl]amino]benzoate;methyl 3-[[2-oxo-2-(6H-pyrazolo[5,4-g][1,3]benzothiazol-2-ylamino)ethyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NCC(=O)Nc2nc3ccc4[nH]ncc4c3s2)c1.COC(=O)c1cccc(NCC(=O)Nc2nc3ccc4[nH]ncc4c3s2)c1 |
| InChI | InChI=1S/C19H17N5O3S.C18H15N5O3S/c1-2-27-18(26)11-4-3-5-12(8-11)20-10-16(25)23-19-22-15-7-6-14-13(9-21-24-14)17(15)28-19;1-26-17(25)10-3-2-4-11(7-10)19-9-15(24)22-18-21-14-6-5-13-12(8-20-23-13)16(14)27-18/h3-9,20H,2,10H2,1H3,(H,21,24)(H,22,23,25);2-8,19H,9H2,1H3,(H,20,23)(H,21,22,24) |
| InChIKey | JTEYORGEMCJNKJ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 218.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.86 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |