About N-ethylpyridazin-3-amine;2-methylbutanoic acid
N-ethylpyridazin-3-amine;2-methylbutanoic acid (PubChem CID 159018673) has the molecular formula C11H19N3O2
and a molecular weight of 225.29 g/mol. Its IUPAC name is N-ethylpyridazin-3-amine;2-methylbutanoic acid.
Molecular Properties
| Compound Name | N-ethylpyridazin-3-amine;2-methylbutanoic acid |
| PubChem CID | 159018673 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-ethylpyridazin-3-amine;2-methylbutanoic acid |
| SMILES | CCC(C)C(=O)O.CCNc1cccnn1 |
| InChI | InChI=1S/C6H9N3.C5H10O2/c1-2-7-6-4-3-5-8-9-6;1-3-4(2)5(6)7/h3-5H,2H2,1H3,(H,7,9);4H,3H2,1-2H3,(H,6,7) |
| InChIKey | JTKKBNJZFDFOKE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethylpyridazin-3-amine;2-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylpyridazin-3-amine;2-methylbutanoic acid?
The IUPAC name of N-ethylpyridazin-3-amine;2-methylbutanoic acid (CID 159018673) is N-ethylpyridazin-3-amine;2-methylbutanoic acid.
What is the SMILES notation for N-ethylpyridazin-3-amine;2-methylbutanoic acid?
The canonical SMILES for N-ethylpyridazin-3-amine;2-methylbutanoic acid is CCC(C)C(=O)O.CCNc1cccnn1.
What is the InChIKey of N-ethylpyridazin-3-amine;2-methylbutanoic acid?
The InChIKey is JTKKBNJZFDFOKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3.C5H10O2/c1-2-7-6-4-3-5-8-9-6;1-3-4(2)5(6)7/h3-5H,2H2,1H3,(H,7,9);4H,3H2,1-2H3,(H,6,7).
What are the key properties of N-ethylpyridazin-3-amine;2-methylbutanoic acid?
N-ethylpyridazin-3-amine;2-methylbutanoic acid has a molecular weight of 225.29 g/mol, XLogP of 2.03, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylpyridazin-3-amine;2-methylbutanoic acid is sourced from PubChem (CID 159018673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).