C20H38O8 — CID 159019841
2-(2-methylperoxyethyl)heptanoic acid;(Z)-2-(2-methylperoxyethyl)hept-2-enoic acid (PubChem CID 159019841) has the molecular formula C20H38O8 and a molecular weight of 406.52 g/mol. Its IUPAC name is 2-(2-methylperoxyethyl)heptanoic acid;(Z)-2-(2-methylperoxyethyl)hept-2-enoic acid.
| Compound Name | 2-(2-methylperoxyethyl)heptanoic acid;(Z)-2-(2-methylperoxyethyl)hept-2-enoic acid |
|---|---|
| PubChem CID | 159019841 |
| Molecular Formula | C20H38O8 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 2-(2-methylperoxyethyl)heptanoic acid;(Z)-2-(2-methylperoxyethyl)hept-2-enoic acid |
| SMILES | CCCC/C=C(/CCOOC)C(=O)O.CCCCCC(CCOOC)C(=O)O |
| InChI | InChI=1S/C10H20O4.C10H18O4/c2*1-3-4-5-6-9(10(11)12)7-8-14-13-2/h9H,3-8H2,1-2H3,(H,11,12);6H,3-5,7-8H2,1-2H3,(H,11,12)/b;9-6- |
| InChIKey | JTNXARLIHLWNRL-UGCXORAOSA-N |
| XLogP | 4.39 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|