About 4-propoxy-2,6-dipyridin-2-ylpyridine
4-propoxy-2,6-dipyridin-2-ylpyridine (PubChem CID 15902132) has the molecular formula C18H17N3O
and a molecular weight of 291.35 g/mol. Its IUPAC name is 4-propoxy-2,6-dipyridin-2-ylpyridine.
Molecular Properties
| Compound Name | 4-propoxy-2,6-dipyridin-2-ylpyridine |
| PubChem CID | 15902132 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 4-propoxy-2,6-dipyridin-2-ylpyridine |
| SMILES | CCCOc1cc(-c2ccccn2)nc(-c2ccccn2)c1 |
| InChI | InChI=1S/C18H17N3O/c1-2-11-22-14-12-17(15-7-3-5-9-19-15)21-18(13-14)16-8-4-6-10-20-16/h3-10,12-13H,2,11H2,1H3 |
| InChIKey | NHBKOWLJQBLIAR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-propoxy-2,6-dipyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propoxy-2,6-dipyridin-2-ylpyridine?
The IUPAC name of 4-propoxy-2,6-dipyridin-2-ylpyridine (CID 15902132) is 4-propoxy-2,6-dipyridin-2-ylpyridine.
What is the SMILES notation for 4-propoxy-2,6-dipyridin-2-ylpyridine?
The canonical SMILES for 4-propoxy-2,6-dipyridin-2-ylpyridine is CCCOc1cc(-c2ccccn2)nc(-c2ccccn2)c1.
What is the InChIKey of 4-propoxy-2,6-dipyridin-2-ylpyridine?
The InChIKey is NHBKOWLJQBLIAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O/c1-2-11-22-14-12-17(15-7-3-5-9-19-15)21-18(13-14)16-8-4-6-10-20-16/h3-10,12-13H,2,11H2,1H3.
What are the key properties of 4-propoxy-2,6-dipyridin-2-ylpyridine?
4-propoxy-2,6-dipyridin-2-ylpyridine has a molecular weight of 291.35 g/mol, XLogP of 3.99, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propoxy-2,6-dipyridin-2-ylpyridine is sourced from PubChem (CID 15902132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).