C35H52BN5O6 — CID 159021566
[1-[(2R)-6-amino-2-[[(2S,5R)-5-[[(2R)-2-amino-3-phenylpropanoyl]amino]-2-(2-methylpropyl)-4-oxo-6-phenylhexanoyl]amino]hexanoyl]pyrrolidin-3-yl]boronic acid (PubChem CID 159021566) has the molecular formula C35H52BN5O6 and a molecular weight of 649.64 g/mol. Its IUPAC name is [1-[(2R)-6-amino-2-[[(2S,5R)-5-[[(2R)-2-amino-3-phenylpropanoyl]amino]-2-(2-methylpropyl)-4-oxo-6-phenylhexanoyl]amino]hexanoyl]pyrrolidin-3-yl]boronic acid.
| Compound Name | [1-[(2R)-6-amino-2-[[(2S,5R)-5-[[(2R)-2-amino-3-phenylpropanoyl]amino]-2-(2-methylpropyl)-4-oxo-6-phenylhexanoyl]amino]hexanoyl]pyrrolidin-3-yl]boronic acid |
|---|---|
| PubChem CID | 159021566 |
| Molecular Formula | C35H52BN5O6 |
| Molecular Weight | 649.64 g/mol |
| Exact Mass | 649.40 |
| IUPAC Name | [1-[(2R)-6-amino-2-[[(2S,5R)-5-[[(2R)-2-amino-3-phenylpropanoyl]amino]-2-(2-methylpropyl)-4-oxo-6-phenylhexanoyl]amino]hexanoyl]pyrrolidin-3-yl]boronic acid |
| SMILES | CC(C)C[C@@H](CC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@H](N)Cc1ccccc1)C(=O)N[C@H](CCCCN)C(=O)N1CCC(B(O)O)C1 |
| InChI | InChI=1S/C35H52BN5O6/c1-24(2)19-27(33(43)39-30(15-9-10-17-37)35(45)41-18-16-28(23-41)36(46)47)22-32(42)31(21-26-13-7-4-8-14-26)40-34(44)29(38)20-25-11-5-3-6-12-25/h3-8,11-14,24,27-31,46-47H,9-10,15-23,37-38H2,1-2H3,(H,39,43)(H,40,44)/t27-,28?,29+,30+,31+/m0/s1 |
| InChIKey | CHISIVODNPGPAF-PZEKTCEKSA-N |
| XLogP | 1.59 |
| TPSA | 188.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.64 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|