C14H21NO4S — CID 159021674
[4-(2-morpholin-4-ylpropyl)phenyl]methanesulfonic acid (PubChem CID 159021674) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is [4-(2-morpholin-4-ylpropyl)phenyl]methanesulfonic acid.
| Compound Name | [4-(2-morpholin-4-ylpropyl)phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 159021674 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | [4-(2-morpholin-4-ylpropyl)phenyl]methanesulfonic acid |
| SMILES | CC(Cc1ccc(CS(=O)(=O)O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C14H21NO4S/c1-12(15-6-8-19-9-7-15)10-13-2-4-14(5-3-13)11-20(16,17)18/h2-5,12H,6-11H2,1H3,(H,16,17,18) |
| InChIKey | LENPIQOSFMSYCR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|